C13H21N5O2S2 — CID 71626169
1-methyl-3-(4-methylphenyl)sulfonyl-1-[(N'-propan-2-ylcarbamimidoyl)amino]thiourea (PubChem CID 71626169) has the molecular formula C13H21N5O2S2 and a molecular weight of 343.48 g/mol. Its IUPAC name is 1-methyl-3-(4-methylphenyl)sulfonyl-1-[(N'-propan-2-ylcarbamimidoyl)amino]thiourea.
| Compound Name | 1-methyl-3-(4-methylphenyl)sulfonyl-1-[(N'-propan-2-ylcarbamimidoyl)amino]thiourea |
|---|---|
| PubChem CID | 71626169 |
| Molecular Formula | C13H21N5O2S2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-methyl-3-(4-methylphenyl)sulfonyl-1-[(N'-propan-2-ylcarbamimidoyl)amino]thiourea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=S)N(C)N/C(N)=N/C(C)C)cc1 |
| InChI | InChI=1S/C13H21N5O2S2/c1-9(2)15-12(14)16-18(4)13(21)17-22(19,20)11-7-5-10(3)6-8-11/h5-9H,1-4H3,(H,17,21)(H3,14,15,16) |
| InChIKey | CJHJUWUJPHBKDF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|