C16H17NO4 — CID 5354444
ethyl (2Z)-2-cyano-2-(4,5-dimethoxy-2,3-dihydroinden-1-ylidene)acetate (PubChem CID 5354444) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl (2Z)-2-cyano-2-(4,5-dimethoxy-2,3-dihydroinden-1-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-cyano-2-(4,5-dimethoxy-2,3-dihydroinden-1-ylidene)acetate |
|---|---|
| PubChem CID | 5354444 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | ethyl (2Z)-2-cyano-2-(4,5-dimethoxy-2,3-dihydroinden-1-ylidene)acetate |
| SMILES | CCOC(=O)/C(C#N)=C1/CCc2c1ccc(OC)c2OC |
| InChI | InChI=1S/C16H17NO4/c1-4-21-16(18)13(9-17)11-5-6-12-10(11)7-8-14(19-2)15(12)20-3/h7-8H,4-6H2,1-3H3/b13-11- |
| InChIKey | CRQCHKYIWDMUDH-QBFSEMIESA-N |
| XLogP | 2.49 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|