C28H25NO6 — CID 84583189
methyl 4-[[(3Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-3-[(4-methoxycarbonylphenyl)methylidene]cyclopentylidene]methyl]benzoate (PubChem CID 84583189) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is methyl 4-[[(3Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-3-[(4-methoxycarbonylphenyl)methylidene]cyclopentylidene]methyl]benzoate.
| Compound Name | methyl 4-[[(3Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-3-[(4-methoxycarbonylphenyl)methylidene]cyclopentylidene]methyl]benzoate |
|---|---|
| PubChem CID | 84583189 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | methyl 4-[[(3Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-3-[(4-methoxycarbonylphenyl)methylidene]cyclopentylidene]methyl]benzoate |
| SMILES | CCOC(=O)/C(C#N)=C1\C(=Cc2ccc(C(=O)OC)cc2)CC\C1=C\c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C28H25NO6/c1-4-35-28(32)24(17-29)25-22(15-18-5-9-20(10-6-18)26(30)33-2)13-14-23(25)16-19-7-11-21(12-8-19)27(31)34-3/h5-12,15-16H,4,13-14H2,1-3H3/b22-15-,23-16?,25-24- |
| InChIKey | QJGQZEVTVRLXHU-QZRLGLDBSA-N |
| XLogP | 4.90 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|