About (Z)-stilbene
(Z)-stilbene (PubChem CID 5356785) has the molecular formula C14H12
and a molecular weight of 180.25 g/mol. Its IUPAC name is (Z)-stilbene.
Molecular Properties
| Compound Name | (Z)-stilbene |
| PubChem CID | 5356785 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (Z)-stilbene |
| SMILES | C(=C\c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| InChIKey | PJANXHGTPQOBST-QXMHVHEDSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-stilbene?
The IUPAC name of (Z)-stilbene (CID 5356785) is (Z)-stilbene.
What is the SMILES notation for (Z)-stilbene?
The canonical SMILES for (Z)-stilbene is C(=C\c1ccccc1)\c1ccccc1.
What is the InChIKey of (Z)-stilbene?
The InChIKey is PJANXHGTPQOBST-QXMHVHEDSA-N. The full InChI is InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11-.
What are the key properties of (Z)-stilbene?
(Z)-stilbene has a molecular weight of 180.25 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-stilbene is sourced from PubChem (CID 5356785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).