C19H21NO6 — CID 5359095
(3Z)-3-[(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methylidene]-1-phenylpyrrolidine-2,5-dione (PubChem CID 5359095) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is (3Z)-3-[(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methylidene]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3Z)-3-[(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methylidene]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5359095 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (3Z)-3-[(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methylidene]-1-phenylpyrrolidine-2,5-dione |
| SMILES | COC1C(/C=C2/CC(=O)N(c3ccccc3)C2=O)OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C19H21NO6/c1-19(2)25-16-15(23-3)13(24-18(16)26-19)9-11-10-14(21)20(17(11)22)12-7-5-4-6-8-12/h4-9,13,15-16,18H,10H2,1-3H3/b11-9- |
| InChIKey | NEKBFWOGTHDBLK-LUAWRHEFSA-N |
| XLogP | 1.77 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|