About CID 5360457
CID 5360457 (PubChem CID 5360457) has the molecular formula HO3Si
and a molecular weight of 77.09 g/mol.
Molecular Properties
| Compound Name | CID 5360457 |
| PubChem CID | 5360457 |
| Molecular Formula | HO3Si |
| Molecular Weight | 77.09 g/mol |
| Exact Mass | 76.97 |
| IUPAC Name | — |
| SMILES | [O][Si](=O)O |
| InChI | InChI=1S/HO3Si/c1-4(2)3/h1H |
| InChIKey | DVGGIKRQUZKXCW-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 77.09 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 5360457 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5360457?
The IUPAC name of CID 5360457 (CID 5360457) is not available.
What is the SMILES notation for CID 5360457?
The canonical SMILES for CID 5360457 is [O][Si](=O)O.
What is the InChIKey of CID 5360457?
The InChIKey is DVGGIKRQUZKXCW-UHFFFAOYSA-N. The full InChI is InChI=1S/HO3Si/c1-4(2)3/h1H.
What are the key properties of CID 5360457?
CID 5360457 has a molecular weight of 77.09 g/mol, XLogP of -1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5360457 is sourced from PubChem (CID 5360457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).