C16H24O3 — CID 5363681
[2-[3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]-2-oxoethyl] acetate (PubChem CID 5363681) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is [2-[3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]-2-oxoethyl] acetate.
| Compound Name | [2-[3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 5363681 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [2-[3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]-2-oxoethyl] acetate |
| SMILES | C=C(C)/C=C/C1C(C(=O)COC(C)=O)CCC1(C)C |
| InChI | InChI=1S/C16H24O3/c1-11(2)6-7-14-13(8-9-16(14,4)5)15(18)10-19-12(3)17/h6-7,13-14H,1,8-10H2,2-5H3/b7-6+ |
| InChIKey | POCDDYPZSRIVBU-VOTSOKGWSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|