C14H24O5 — CID 5364250
methyl (2E,4E)-7-hydroxy-9-(methoxymethoxy)-6,8-dimethylnona-2,4-dienoate (PubChem CID 5364250) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is methyl (2E,4E)-7-hydroxy-9-(methoxymethoxy)-6,8-dimethylnona-2,4-dienoate.
| Compound Name | methyl (2E,4E)-7-hydroxy-9-(methoxymethoxy)-6,8-dimethylnona-2,4-dienoate |
|---|---|
| PubChem CID | 5364250 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | methyl (2E,4E)-7-hydroxy-9-(methoxymethoxy)-6,8-dimethylnona-2,4-dienoate |
| SMILES | COCOCC(C)C(O)C(C)/C=C/C=C/C(=O)OC |
| InChI | InChI=1S/C14H24O5/c1-11(7-5-6-8-13(15)18-4)14(16)12(2)9-19-10-17-3/h5-8,11-12,14,16H,9-10H2,1-4H3/b7-5+,8-6+ |
| InChIKey | QNBQKGITPWCNNY-KQQUZDAGSA-N |
| XLogP | 1.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|