C24H32O7S — CID 5368834
methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-11-[(Z)-prop-1-enyl]-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylate (PubChem CID 5368834) has the molecular formula C24H32O7S and a molecular weight of 464.58 g/mol. Its IUPAC name is methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-11-[(Z)-prop-1-enyl]-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylate.
| Compound Name | methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-11-[(Z)-prop-1-enyl]-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylate |
|---|---|
| PubChem CID | 5368834 |
| Molecular Formula | C24H32O7S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-11-[(Z)-prop-1-enyl]-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylate |
| SMILES | C/C=C\C1CC2OC3(CCCC(OS(=O)(=O)c4ccc(C)cc4)C3(C)CC2C(=O)OC)O1 |
| InChI | InChI=1S/C24H32O7S/c1-5-7-17-14-20-19(22(25)28-4)15-23(3)21(8-6-13-24(23,29-17)30-20)31-32(26,27)18-11-9-16(2)10-12-18/h5,7,9-12,17,19-21H,6,8,13-15H2,1-4H3/b7-5- |
| InChIKey | VDFOBRVDTUCTEQ-ALCCZGGFSA-N |
| XLogP | 3.90 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|