C21H28O7S — CID 620017
methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylate (PubChem CID 620017) has the molecular formula C21H28O7S and a molecular weight of 424.52 g/mol. Its IUPAC name is methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylate.
| Compound Name | methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylate |
|---|---|
| PubChem CID | 620017 |
| Molecular Formula | C21H28O7S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylate |
| SMILES | COC(=O)C1CC2(C)C(OS(=O)(=O)c3ccc(C)cc3)CCCC23OCCC1O3 |
| InChI | InChI=1S/C21H28O7S/c1-14-6-8-15(9-7-14)29(23,24)28-18-5-4-11-21-20(18,2)13-16(19(22)25-3)17(27-21)10-12-26-21/h6-9,16-18H,4-5,10-13H2,1-3H3 |
| InChIKey | UJECMWCZHJHZAG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|