C20H26O7S — CID 617369
methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-11,12-dioxatricyclo[7.2.1.01,6]dodecane-8-carboxylate (PubChem CID 617369) has the molecular formula C20H26O7S and a molecular weight of 410.49 g/mol. Its IUPAC name is methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-11,12-dioxatricyclo[7.2.1.01,6]dodecane-8-carboxylate.
| Compound Name | methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-11,12-dioxatricyclo[7.2.1.01,6]dodecane-8-carboxylate |
|---|---|
| PubChem CID | 617369 |
| Molecular Formula | C20H26O7S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | methyl 6-methyl-5-(4-methylphenyl)sulfonyloxy-11,12-dioxatricyclo[7.2.1.01,6]dodecane-8-carboxylate |
| SMILES | COC(=O)C1CC2(C)C(OS(=O)(=O)c3ccc(C)cc3)CCCC23OCC1O3 |
| InChI | InChI=1S/C20H26O7S/c1-13-6-8-14(9-7-13)28(22,23)27-17-5-4-10-20-19(17,2)11-15(18(21)24-3)16(26-20)12-25-20/h6-9,15-17H,4-5,10-12H2,1-3H3 |
| InChIKey | YZPWCQOVOGAPKO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|