C23H28O13S — CID 102478996
methyl (2S)-2-[(1R,3S,5R,6R,8R)-5,8-diacetyloxy-6-(acetyloxymethyl)-2,7-dioxabicyclo[3.2.1]octan-3-yl]-2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 102478996) has the molecular formula C23H28O13S and a molecular weight of 544.53 g/mol. Its IUPAC name is methyl (2S)-2-[(1R,3S,5R,6R,8R)-5,8-diacetyloxy-6-(acetyloxymethyl)-2,7-dioxabicyclo[3.2.1]octan-3-yl]-2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | methyl (2S)-2-[(1R,3S,5R,6R,8R)-5,8-diacetyloxy-6-(acetyloxymethyl)-2,7-dioxabicyclo[3.2.1]octan-3-yl]-2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 102478996 |
| Molecular Formula | C23H28O13S |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | methyl (2S)-2-[(1R,3S,5R,6R,8R)-5,8-diacetyloxy-6-(acetyloxymethyl)-2,7-dioxabicyclo[3.2.1]octan-3-yl]-2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | COC(=O)[C@@H](OS(=O)(=O)c1ccc(C)cc1)[C@@H]1C[C@@]2(OC(C)=O)[C@@H](COC(C)=O)O[C@@H](O1)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C23H28O13S/c1-12-6-8-16(9-7-12)37(28,29)36-19(21(27)30-5)17-10-23(35-15(4)26)18(11-31-13(2)24)34-22(33-17)20(23)32-14(3)25/h6-9,17-20,22H,10-11H2,1-5H3/t17-,18+,19-,20-,22+,23+/m0/s1 |
| InChIKey | BENKTQPFQIQXEP-PQNCRPGBSA-N |
| XLogP | 0.55 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|