C20H26O7S — CID 617346
6-methyl-5-(4-methylphenyl)sulfonyloxy-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylic acid (PubChem CID 617346) has the molecular formula C20H26O7S and a molecular weight of 410.49 g/mol. Its IUPAC name is 6-methyl-5-(4-methylphenyl)sulfonyloxy-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylic acid.
| Compound Name | 6-methyl-5-(4-methylphenyl)sulfonyloxy-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylic acid |
|---|---|
| PubChem CID | 617346 |
| Molecular Formula | C20H26O7S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 6-methyl-5-(4-methylphenyl)sulfonyloxy-12,13-dioxatricyclo[7.3.1.01,6]tridecane-8-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCC34OCCC(O3)C(C(=O)O)CC24C)cc1 |
| InChI | InChI=1S/C20H26O7S/c1-13-5-7-14(8-6-13)28(23,24)27-17-4-3-10-20-19(17,2)12-15(18(21)22)16(26-20)9-11-25-20/h5-8,15-17H,3-4,9-12H2,1-2H3,(H,21,22) |
| InChIKey | UEZVSBYYJVUWGF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|