C10H16O — CID 5368938
(5E)-2,6-dimethylocta-5,7-dien-4-one (PubChem CID 5368938) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (5E)-2,6-dimethylocta-5,7-dien-4-one.
| Compound Name | (5E)-2,6-dimethylocta-5,7-dien-4-one |
|---|---|
| PubChem CID | 5368938 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (5E)-2,6-dimethylocta-5,7-dien-4-one |
| SMILES | C=C/C(C)=C/C(=O)CC(C)C |
| InChI | InChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5,7-8H,1,6H2,2-4H3/b9-7+ |
| InChIKey | RJXKHBTYHGBOKV-VQHVLOKHSA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|