C13H12F2N4O — CID 5371131
N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-2,5-difluorobenzamide (PubChem CID 5371131) has the molecular formula C13H12F2N4O and a molecular weight of 278.26 g/mol. Its IUPAC name is N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-2,5-difluorobenzamide.
| Compound Name | N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 5371131 |
| Molecular Formula | C13H12F2N4O |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-2,5-difluorobenzamide |
| SMILES | Cc1c(/C=N\NC(=O)c2cc(F)ccc2F)cnn1C |
| InChI | InChI=1S/C13H12F2N4O/c1-8-9(7-17-19(8)2)6-16-18-13(20)11-5-10(14)3-4-12(11)15/h3-7H,1-2H3,(H,18,20)/b16-6- |
| InChIKey | BJBKLZDLUCSSGI-SOFYXZRVSA-N |
| XLogP | 1.77 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|