C13H10O4 — CID 5371535
(4Z)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-3H-furan]-3'-ol (PubChem CID 5371535) has the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is (4Z)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-3H-furan]-3'-ol.
| Compound Name | (4Z)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-3H-furan]-3'-ol |
|---|---|
| PubChem CID | 5371535 |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (4Z)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-3H-furan]-3'-ol |
| SMILES | CC#CC#C/C=C1\OC2(OC=CC2O)C2OC12 |
| InChI | InChI=1S/C13H10O4/c1-2-3-4-5-6-9-11-12(16-11)13(17-9)10(14)7-8-15-13/h6-8,10-12,14H,1H3/b9-6- |
| InChIKey | KDIQIPYZEGXJKP-TWGQIWQCSA-N |
| XLogP | 0.30 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|