C25H50O5Si2 — CID 5376673
methyl (Z)-12-(5-ethyloxolan-2-yl)-7,12-bis(trimethylsilyloxy)dodec-9-enoate (PubChem CID 5376673) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is methyl (Z)-12-(5-ethyloxolan-2-yl)-7,12-bis(trimethylsilyloxy)dodec-9-enoate.
| Compound Name | methyl (Z)-12-(5-ethyloxolan-2-yl)-7,12-bis(trimethylsilyloxy)dodec-9-enoate |
|---|---|
| PubChem CID | 5376673 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | methyl (Z)-12-(5-ethyloxolan-2-yl)-7,12-bis(trimethylsilyloxy)dodec-9-enoate |
| SMILES | CCC1CCC(C(C/C=C\CC(CCCCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C)O1 |
| InChI | InChI=1S/C25H50O5Si2/c1-9-21-19-20-23(28-21)24(30-32(6,7)8)17-14-13-16-22(29-31(3,4)5)15-11-10-12-18-25(26)27-2/h13-14,21-24H,9-12,15-20H2,1-8H3/b14-13- |
| InChIKey | HRUQWBXURLIKED-YPKPFQOOSA-N |
| XLogP | 6.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|