C14H15N3OS — CID 5376975
4-[(Z)-2-phenyl-2-(1,2,4-thiadiazol-5-yl)ethenyl]morpholine (PubChem CID 5376975) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 4-[(Z)-2-phenyl-2-(1,2,4-thiadiazol-5-yl)ethenyl]morpholine.
| Compound Name | 4-[(Z)-2-phenyl-2-(1,2,4-thiadiazol-5-yl)ethenyl]morpholine |
|---|---|
| PubChem CID | 5376975 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-[(Z)-2-phenyl-2-(1,2,4-thiadiazol-5-yl)ethenyl]morpholine |
| SMILES | C(=C(/c1ccccc1)c1ncns1)\N1CCOCC1 |
| InChI | InChI=1S/C14H15N3OS/c1-2-4-12(5-3-1)13(14-15-11-16-19-14)10-17-6-8-18-9-7-17/h1-5,10-11H,6-9H2/b13-10- |
| InChIKey | NKFBBAWOTBWVRW-RAXLEYEMSA-N |
| XLogP | 2.26 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |