C28H24N2O — CID 5378755
(Z)-3-anilino-N,2,4-triphenylbut-2-enamide (PubChem CID 5378755) has the molecular formula C28H24N2O and a molecular weight of 404.51 g/mol. Its IUPAC name is (Z)-3-anilino-N,2,4-triphenylbut-2-enamide.
| Compound Name | (Z)-3-anilino-N,2,4-triphenylbut-2-enamide |
|---|---|
| PubChem CID | 5378755 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (Z)-3-anilino-N,2,4-triphenylbut-2-enamide |
| SMILES | O=C(Nc1ccccc1)/C(=C(/Cc1ccccc1)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24N2O/c31-28(30-25-19-11-4-12-20-25)27(23-15-7-2-8-16-23)26(21-22-13-5-1-6-14-22)29-24-17-9-3-10-18-24/h1-20,29H,21H2,(H,30,31)/b27-26- |
| InChIKey | LTINZIIBMAXMKA-RQZHXJHFSA-N |
| XLogP | 6.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|