C24H22FNO3S — CID 142958817
(E)-N-(4-fluorophenyl)-3-methyl-4-(4-methylsulfonylphenyl)-2-phenylbut-2-enamide (PubChem CID 142958817) has the molecular formula C24H22FNO3S and a molecular weight of 423.51 g/mol. Its IUPAC name is (E)-N-(4-fluorophenyl)-3-methyl-4-(4-methylsulfonylphenyl)-2-phenylbut-2-enamide.
| Compound Name | (E)-N-(4-fluorophenyl)-3-methyl-4-(4-methylsulfonylphenyl)-2-phenylbut-2-enamide |
|---|---|
| PubChem CID | 142958817 |
| Molecular Formula | C24H22FNO3S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (E)-N-(4-fluorophenyl)-3-methyl-4-(4-methylsulfonylphenyl)-2-phenylbut-2-enamide |
| SMILES | C/C(Cc1ccc(S(C)(=O)=O)cc1)=C(\C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22FNO3S/c1-17(16-18-8-14-22(15-9-18)30(2,28)29)23(19-6-4-3-5-7-19)24(27)26-21-12-10-20(25)11-13-21/h3-15H,16H2,1-2H3,(H,26,27)/b23-17+ |
| InChIKey | OACMSOGKAPMYQQ-HAVVHWLPSA-N |
| XLogP | 4.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|