C17H30O4 — CID 538078
(10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl) acetate (PubChem CID 538078) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is (10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl) acetate.
| Compound Name | (10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl) acetate |
|---|---|
| PubChem CID | 538078 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl) acetate |
| SMILES | CC(=O)OCC=C(C)CCC=C(C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C17H30O4/c1-13(9-10-16(19)17(4,5)20)7-6-8-14(2)11-12-21-15(3)18/h7,11,16,19-20H,6,8-10,12H2,1-5H3 |
| InChIKey | ULROVNMFUUTDMH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|