C19H20O4S — CID 5385021
4-ethoxy-2-methoxy-1-[(E)-2-[(Z)-2-phenylethenyl]sulfonylethenyl]benzene (PubChem CID 5385021) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-ethoxy-2-methoxy-1-[(E)-2-[(Z)-2-phenylethenyl]sulfonylethenyl]benzene.
| Compound Name | 4-ethoxy-2-methoxy-1-[(E)-2-[(Z)-2-phenylethenyl]sulfonylethenyl]benzene |
|---|---|
| PubChem CID | 5385021 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-ethoxy-2-methoxy-1-[(E)-2-[(Z)-2-phenylethenyl]sulfonylethenyl]benzene |
| SMILES | CCOc1ccc(/C=C/S(=O)(=O)/C=C\c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C19H20O4S/c1-3-23-18-10-9-17(19(15-18)22-2)12-14-24(20,21)13-11-16-7-5-4-6-8-16/h4-15H,3H2,1-2H3/b13-11-,14-12+ |
| InChIKey | JFCFJZFATQUBQO-HEEUSZRZSA-N |
| XLogP | 4.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |