C16H21BrO2 — CID 5386672
2-bromo-5-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,4-diol (PubChem CID 5386672) has the molecular formula C16H21BrO2 and a molecular weight of 325.25 g/mol. Its IUPAC name is 2-bromo-5-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,4-diol.
| Compound Name | 2-bromo-5-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 5386672 |
| Molecular Formula | C16H21BrO2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-bromo-5-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,4-diol |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(O)c(Br)cc1O |
| InChI | InChI=1S/C16H21BrO2/c1-11(2)5-4-6-12(3)7-8-13-9-16(19)14(17)10-15(13)18/h5,7,9-10,18-19H,4,6,8H2,1-3H3/b12-7+ |
| InChIKey | IUFDABCKTYWJDR-KPKJPENVSA-N |
| XLogP | 5.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|