C16H21BrO2 — CID 10782276
5-bromo-2-[(2,2-dimethyl-5-methylidenecyclopentyl)methyl]-4-methoxyphenol (PubChem CID 10782276) has the molecular formula C16H21BrO2 and a molecular weight of 325.25 g/mol. Its IUPAC name is 5-bromo-2-[(2,2-dimethyl-5-methylidenecyclopentyl)methyl]-4-methoxyphenol.
| Compound Name | 5-bromo-2-[(2,2-dimethyl-5-methylidenecyclopentyl)methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 10782276 |
| Molecular Formula | C16H21BrO2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 5-bromo-2-[(2,2-dimethyl-5-methylidenecyclopentyl)methyl]-4-methoxyphenol |
| SMILES | C=C1CCC(C)(C)C1Cc1cc(OC)c(Br)cc1O |
| InChI | InChI=1S/C16H21BrO2/c1-10-5-6-16(2,3)12(10)7-11-8-15(19-4)13(17)9-14(11)18/h8-9,12,18H,1,5-7H2,2-4H3 |
| InChIKey | ZHVKQLMQUPEPHX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|