C9H9NO3 — CID 5386800
N-[(E)-2-(2,3-dihydroxyphenyl)ethenyl]formamide (PubChem CID 5386800) has the molecular formula C9H9NO3 and a molecular weight of 179.18 g/mol. Its IUPAC name is N-[(E)-2-(2,3-dihydroxyphenyl)ethenyl]formamide.
| Compound Name | N-[(E)-2-(2,3-dihydroxyphenyl)ethenyl]formamide |
|---|---|
| PubChem CID | 5386800 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | N-[(E)-2-(2,3-dihydroxyphenyl)ethenyl]formamide |
| SMILES | O=CN/C=C/c1cccc(O)c1O |
| InChI | InChI=1S/C9H9NO3/c11-6-10-5-4-7-2-1-3-8(12)9(7)13/h1-6,12-13H,(H,10,11)/b5-4+ |
| InChIKey | OSQBLWALIFYAPC-SNAWJCMRSA-N |
| XLogP | 0.81 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|