C9H7F2NO — CID 102120376
N-[(E)-2-(2,6-difluorophenyl)ethenyl]formamide (PubChem CID 102120376) has the molecular formula C9H7F2NO and a molecular weight of 183.16 g/mol. Its IUPAC name is N-[(E)-2-(2,6-difluorophenyl)ethenyl]formamide.
| Compound Name | N-[(E)-2-(2,6-difluorophenyl)ethenyl]formamide |
|---|---|
| PubChem CID | 102120376 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | N-[(E)-2-(2,6-difluorophenyl)ethenyl]formamide |
| SMILES | O=CN/C=C/c1c(F)cccc1F |
| InChI | InChI=1S/C9H7F2NO/c10-8-2-1-3-9(11)7(8)4-5-12-6-13/h1-6H,(H,12,13)/b5-4+ |
| InChIKey | HXRNHORANIXABT-SNAWJCMRSA-N |
| XLogP | 1.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|