C8H5BrF2 — CID 123354850
2-(2-bromoethenyl)-1,3-difluorobenzene (PubChem CID 123354850) has the molecular formula C8H5BrF2 and a molecular weight of 219.03 g/mol. Its IUPAC name is 2-(2-bromoethenyl)-1,3-difluorobenzene.
| Compound Name | 2-(2-bromoethenyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 123354850 |
| Molecular Formula | C8H5BrF2 |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | 2-(2-bromoethenyl)-1,3-difluorobenzene |
| SMILES | Fc1cccc(F)c1C=CBr |
| InChI | InChI=1S/C8H5BrF2/c9-5-4-6-7(10)2-1-3-8(6)11/h1-5H |
| InChIKey | HGYOURXXPPQUBQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |