C30H51ClN2O3 — CID 5388009
3-[(Z)-heptadec-10-enyl]-5-methoxy-2-[(4-methylpiperazin-1-yl)methyl]cyclohexa-2,5-diene-1,4-dione;hydrochloride (PubChem CID 5388009) has the molecular formula C30H51ClN2O3 and a molecular weight of 523.20 g/mol. Its IUPAC name is 3-[(Z)-heptadec-10-enyl]-5-methoxy-2-[(4-methylpiperazin-1-yl)methyl]cyclohexa-2,5-diene-1,4-dione;hydrochloride.
| Compound Name | 3-[(Z)-heptadec-10-enyl]-5-methoxy-2-[(4-methylpiperazin-1-yl)methyl]cyclohexa-2,5-diene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 5388009 |
| Molecular Formula | C30H51ClN2O3 |
| Molecular Weight | 523.20 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | 3-[(Z)-heptadec-10-enyl]-5-methoxy-2-[(4-methylpiperazin-1-yl)methyl]cyclohexa-2,5-diene-1,4-dione;hydrochloride |
| SMILES | CCCCCC/C=C\CCCCCCCCCC1=C(CN2CCN(C)CC2)C(=O)C=C(OC)C1=O.Cl |
| InChI | InChI=1S/C30H50N2O3.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26-27(25-32-22-20-31(2)21-23-32)28(33)24-29(35-3)30(26)34;/h9-10,24H,4-8,11-23,25H2,1-3H3;1H/b10-9-; |
| InChIKey | VLKPJWYFDCWKGL-KVVVOXFISA-N |
| XLogP | 6.67 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.20 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|