C11H9N3O2S — CID 5400300
N-[(4Z)-5-oxo-4-(pyridin-3-ylmethylidene)-1,3-thiazol-2-yl]acetamide (PubChem CID 5400300) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is N-[(4Z)-5-oxo-4-(pyridin-3-ylmethylidene)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[(4Z)-5-oxo-4-(pyridin-3-ylmethylidene)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 5400300 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | N-[(4Z)-5-oxo-4-(pyridin-3-ylmethylidene)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=N/C(=C\c2cccnc2)C(=O)S1 |
| InChI | InChI=1S/C11H9N3O2S/c1-7(15)13-11-14-9(10(16)17-11)5-8-3-2-4-12-6-8/h2-6H,1H3,(H,13,14,15)/b9-5- |
| InChIKey | JUSMFYWCDZXYRD-UITAMQMPSA-N |
| XLogP | 1.19 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|