C19H29ClN2O7P2 — CID 54004640
[5,5-bis(diethoxyphosphoryl)-3,4-dihydropyrazol-3-yl]-(4-chloro-3-methylphenyl)methanone (PubChem CID 54004640) has the molecular formula C19H29ClN2O7P2 and a molecular weight of 494.85 g/mol. Its IUPAC name is [5,5-bis(diethoxyphosphoryl)-3,4-dihydropyrazol-3-yl]-(4-chloro-3-methylphenyl)methanone.
| Compound Name | [5,5-bis(diethoxyphosphoryl)-3,4-dihydropyrazol-3-yl]-(4-chloro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 54004640 |
| Molecular Formula | C19H29ClN2O7P2 |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | [5,5-bis(diethoxyphosphoryl)-3,4-dihydropyrazol-3-yl]-(4-chloro-3-methylphenyl)methanone |
| SMILES | CCOP(=O)(OCC)C1(P(=O)(OCC)OCC)CC(C(=O)c2ccc(Cl)c(C)c2)N=N1 |
| InChI | InChI=1S/C19H29ClN2O7P2/c1-6-26-30(24,27-7-2)19(31(25,28-8-3)29-9-4)13-17(21-22-19)18(23)15-10-11-16(20)14(5)12-15/h10-12,17H,6-9,13H2,1-5H3 |
| InChIKey | KNZDPFUUHMRPRT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 112.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|