C24H44N2O2Si — CID 54006528
N-[3-(benzylamino)-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]heptanamide (PubChem CID 54006528) has the molecular formula C24H44N2O2Si and a molecular weight of 420.71 g/mol. Its IUPAC name is N-[3-(benzylamino)-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]heptanamide.
| Compound Name | N-[3-(benzylamino)-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]heptanamide |
|---|---|
| PubChem CID | 54006528 |
| Molecular Formula | C24H44N2O2Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | N-[3-(benzylamino)-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)NC(CO[Si](C)(C)C(C)(C)C)C(C)NCc1ccccc1 |
| InChI | InChI=1S/C24H44N2O2Si/c1-8-9-10-14-17-23(27)26-22(19-28-29(6,7)24(3,4)5)20(2)25-18-21-15-12-11-13-16-21/h11-13,15-16,20,22,25H,8-10,14,17-19H2,1-7H3,(H,26,27) |
| InChIKey | KPGPYAROPSAQRS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|