C8H10F2N2S — CID 54007590
2-[(2,6-difluoro-4-pyridinyl)methylamino]ethanethiol (PubChem CID 54007590) has the molecular formula C8H10F2N2S and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-[(2,6-difluoro-4-pyridinyl)methylamino]ethanethiol.
| Compound Name | 2-[(2,6-difluoro-4-pyridinyl)methylamino]ethanethiol |
|---|---|
| PubChem CID | 54007590 |
| Molecular Formula | C8H10F2N2S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2-[(2,6-difluoro-4-pyridinyl)methylamino]ethanethiol |
| SMILES | Fc1cc(CNCCS)cc(F)n1 |
| InChI | InChI=1S/C8H10F2N2S/c9-7-3-6(4-8(10)12-7)5-11-1-2-13/h3-4,11,13H,1-2,5H2 |
| InChIKey | KPZOONOZJZFBIE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|