C12H23N3 — CID 54008961
3,5-dimethyl-1-octyl-1,2,4-triazole (PubChem CID 54008961) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 3,5-dimethyl-1-octyl-1,2,4-triazole.
| Compound Name | 3,5-dimethyl-1-octyl-1,2,4-triazole |
|---|---|
| PubChem CID | 54008961 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 3,5-dimethyl-1-octyl-1,2,4-triazole |
| SMILES | CCCCCCCCn1nc(C)nc1C |
| InChI | InChI=1S/C12H23N3/c1-4-5-6-7-8-9-10-15-12(3)13-11(2)14-15/h4-10H2,1-3H3 |
| InChIKey | KQXZATFXKGHQAI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|