C7H12FN3 — CID 130636621
1-(3-fluoropropyl)-3,5-dimethyl-1,2,4-triazole (PubChem CID 130636621) has the molecular formula C7H12FN3 and a molecular weight of 157.19 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-3,5-dimethyl-1,2,4-triazole.
| Compound Name | 1-(3-fluoropropyl)-3,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 130636621 |
| Molecular Formula | C7H12FN3 |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 1-(3-fluoropropyl)-3,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nc(C)n(CCCF)n1 |
| InChI | InChI=1S/C7H12FN3/c1-6-9-7(2)11(10-6)5-3-4-8/h3-5H2,1-2H3 |
| InChIKey | ZHIAXBJKZOHWDY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |