C27H35F3N2O5 — CID 54017434
(2,5-dihydroxypyrrol-1-yl) 4-[8-cyclohexyloctyl-(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 54017434) has the molecular formula C27H35F3N2O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[8-cyclohexyloctyl-(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[8-cyclohexyloctyl-(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 54017434 |
| Molecular Formula | C27H35F3N2O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[8-cyclohexyloctyl-(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | O=C(On1c(O)ccc1O)c1ccc(N(CCCCCCCCC2CCCCC2)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H35F3N2O5/c28-27(29,30)26(36)31(19-9-4-2-1-3-6-10-20-11-7-5-8-12-20)22-15-13-21(14-16-22)25(35)37-32-23(33)17-18-24(32)34/h13-18,20,33-34H,1-12,19H2 |
| InChIKey | KWOJLMRMMVPGLH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|