C28H28F3N3O7 — CID 90736181
(2,5-dihydroxypyrrol-1-yl) 6-[[3-(4-benzoylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]hexanoate (PubChem CID 90736181) has the molecular formula C28H28F3N3O7 and a molecular weight of 575.54 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[[3-(4-benzoylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[[3-(4-benzoylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 90736181 |
| Molecular Formula | C28H28F3N3O7 |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[[3-(4-benzoylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]hexanoate |
| SMILES | O=C(CCCCCNC(=O)C(Cc1ccc(C(=O)c2ccccc2)cc1)NC(=O)C(F)(F)F)On1c(O)ccc1O |
| InChI | InChI=1S/C28H28F3N3O7/c29-28(30,31)27(40)33-21(17-18-10-12-20(13-11-18)25(38)19-7-3-1-4-8-19)26(39)32-16-6-2-5-9-24(37)41-34-22(35)14-15-23(34)36/h1,3-4,7-8,10-15,21,35-36H,2,5-6,9,16-17H2,(H,32,39)(H,33,40) |
| InChIKey | BMGCGWMOPZAGTJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|