C21H24F2N4O7 — CID 91196548
(2,5-dihydroxypyrrol-1-yl) 2-[(2-benzamidoacetyl)amino]-6-[(2,2-difluoroacetyl)amino]hexanoate (PubChem CID 91196548) has the molecular formula C21H24F2N4O7 and a molecular weight of 482.44 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[(2-benzamidoacetyl)amino]-6-[(2,2-difluoroacetyl)amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[(2-benzamidoacetyl)amino]-6-[(2,2-difluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 91196548 |
| Molecular Formula | C21H24F2N4O7 |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[(2-benzamidoacetyl)amino]-6-[(2,2-difluoroacetyl)amino]hexanoate |
| SMILES | O=C(CNC(=O)c1ccccc1)NC(CCCCNC(=O)C(F)F)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C21H24F2N4O7/c22-18(23)20(32)24-11-5-4-8-14(21(33)34-27-16(29)9-10-17(27)30)26-15(28)12-25-19(31)13-6-2-1-3-7-13/h1-3,6-7,9-10,14,18,29-30H,4-5,8,11-12H2,(H,24,32)(H,25,31)(H,26,28) |
| InChIKey | IFSYDSCSUFPWRG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 158.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|