C18H16F5N3O6S — CID 54117627
(2,5-dihydroxypyrrol-1-yl) 2-[[(2S)-4-methylsulfanyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoyl]amino]acetate (PubChem CID 54117627) has the molecular formula C18H16F5N3O6S and a molecular weight of 497.40 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[[(2S)-4-methylsulfanyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoyl]amino]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[[(2S)-4-methylsulfanyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoyl]amino]acetate |
|---|---|
| PubChem CID | 54117627 |
| Molecular Formula | C18H16F5N3O6S |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[[(2S)-4-methylsulfanyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoyl]amino]acetate |
| SMILES | CSCC[C@H](NC(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)NCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C18H16F5N3O6S/c1-33-5-4-7(17(30)24-6-10(29)32-26-8(27)2-3-9(26)28)25-18(31)11-12(19)14(21)16(23)15(22)13(11)20/h2-3,7,27-28H,4-6H2,1H3,(H,24,30)(H,25,31)/t7-/m0/s1 |
| InChIKey | NLLMXWLKRPPIBM-ZETCQYMHSA-N |
| XLogP | 1.22 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|