C26H24F3N3O7 — CID 91488381
(2,5-dihydroxypyrrol-1-yl) (2S)-2-[(4-benzoylbenzoyl)amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 91488381) has the molecular formula C26H24F3N3O7 and a molecular weight of 547.49 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-2-[(4-benzoylbenzoyl)amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-[(4-benzoylbenzoyl)amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 91488381 |
| Molecular Formula | C26H24F3N3O7 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-[(4-benzoylbenzoyl)amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | O=C(N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)On1c(O)ccc1O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24F3N3O7/c27-26(28,29)25(38)30-15-5-4-8-19(24(37)39-32-20(33)13-14-21(32)34)31-23(36)18-11-9-17(10-12-18)22(35)16-6-2-1-3-7-16/h1-3,6-7,9-14,19,33-34H,4-5,8,15H2,(H,30,38)(H,31,36)/t19-/m0/s1 |
| InChIKey | DNDWXLOLRYTCJI-IBGZPJMESA-N |
| XLogP | 2.73 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|