C27H35F3N2O5 — CID 54317860
(2,5-dihydroxypyrrol-1-yl) 2-[tetradec-4-enyl-(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 54317860) has the molecular formula C27H35F3N2O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[tetradec-4-enyl-(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[tetradec-4-enyl-(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 54317860 |
| Molecular Formula | C27H35F3N2O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[tetradec-4-enyl-(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | CCCCCCCCCC=CCCCN(C(=O)C(F)(F)F)c1ccccc1C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C27H35F3N2O5/c1-2-3-4-5-6-7-8-9-10-11-12-15-20-31(26(36)27(28,29)30)22-17-14-13-16-21(22)25(35)37-32-23(33)18-19-24(32)34/h10-11,13-14,16-19,33-34H,2-9,12,15,20H2,1H3 |
| InChIKey | SPNANDUALZISTL-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|