C31H36F8N4O8Si — CID 91168466
(2,5-dihydroxypyrrol-1-yl) 2,3,5,6-tetrafluoro-4-[5-[2,3,5,6-tetrafluoro-4-(2-trimethoxysilylethylcarbamoyl)anilino]octan-4-ylamino]benzoate (PubChem CID 91168466) has the molecular formula C31H36F8N4O8Si and a molecular weight of 772.72 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2,3,5,6-tetrafluoro-4-[5-[2,3,5,6-tetrafluoro-4-(2-trimethoxysilylethylcarbamoyl)anilino]octan-4-ylamino]benzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2,3,5,6-tetrafluoro-4-[5-[2,3,5,6-tetrafluoro-4-(2-trimethoxysilylethylcarbamoyl)anilino]octan-4-ylamino]benzoate |
|---|---|
| PubChem CID | 91168466 |
| Molecular Formula | C31H36F8N4O8Si |
| Molecular Weight | 772.72 g/mol |
| Exact Mass | 772.22 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2,3,5,6-tetrafluoro-4-[5-[2,3,5,6-tetrafluoro-4-(2-trimethoxysilylethylcarbamoyl)anilino]octan-4-ylamino]benzoate |
| SMILES | CCCC(Nc1c(F)c(F)c(C(=O)NCC[Si](OC)(OC)OC)c(F)c1F)C(CCC)Nc1c(F)c(F)c(C(=O)On2c(O)ccc2O)c(F)c1F |
| InChI | InChI=1S/C31H36F8N4O8Si/c1-6-8-14(41-28-24(36)20(32)18(21(33)25(28)37)30(46)40-12-13-52(48-3,49-4)50-5)15(9-7-2)42-29-26(38)22(34)19(23(35)27(29)39)31(47)51-43-16(44)10-11-17(43)45/h10-11,14-15,41-42,44-45H,6-9,12-13H2,1-5H3,(H,40,46) |
| InChIKey | WTJZLMSRQTYXGG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 152.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|