C19H36N4O5 — CID 54018893
tert-butyl N-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]-[(2S)-4-methyl-1-oxopentan-2-yl]amino]carbamate (PubChem CID 54018893) has the molecular formula C19H36N4O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]-[(2S)-4-methyl-1-oxopentan-2-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]-[(2S)-4-methyl-1-oxopentan-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 54018893 |
| Molecular Formula | C19H36N4O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | tert-butyl N-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]-[(2S)-4-methyl-1-oxopentan-2-yl]amino]carbamate |
| SMILES | CC(C)C[C@@H](C=O)N(NC(=O)OC(C)(C)C)C(=O)[C@H](C)NC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C19H36N4O5/c1-11(2)9-14(10-24)23(22-18(27)28-19(6,7)8)17(26)13(5)21-16(25)15(20)12(3)4/h10-15H,9,20H2,1-8H3,(H,21,25)(H,22,27)/t13-,14-,15-/m0/s1 |
| InChIKey | KXNQFPYFSMGQNT-KKUMJFAQSA-N |
| XLogP | 1.36 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|