C22H37FO4 — CID 54019109
7-[(1R,2R)-2-(4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]-2-fluoro-2-hydroxyheptanoic acid (PubChem CID 54019109) has the molecular formula C22H37FO4 and a molecular weight of 384.53 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]-2-fluoro-2-hydroxyheptanoic acid.
| Compound Name | 7-[(1R,2R)-2-(4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]-2-fluoro-2-hydroxyheptanoic acid |
|---|---|
| PubChem CID | 54019109 |
| Molecular Formula | C22H37FO4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 7-[(1R,2R)-2-(4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]-2-fluoro-2-hydroxyheptanoic acid |
| SMILES | CCCCC(C)(C)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(O)(F)C(=O)O |
| InChI | InChI=1S/C22H37FO4/c1-4-5-14-21(2,3)15-9-10-17-12-13-19(24)18(17)11-7-6-8-16-22(23,27)20(25)26/h9-10,17-18,27H,4-8,11-16H2,1-3H3,(H,25,26)/t17-,18+,22?/m0/s1 |
| InChIKey | KXRGXVKVOAJBRQ-WQFBUZOZSA-N |
| XLogP | 5.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|