C13H16FN3O4 — CID 54019185
(2R,3S,4R,5S,6S)-4-azido-5-fluoro-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-ol (PubChem CID 54019185) has the molecular formula C13H16FN3O4 and a molecular weight of 297.29 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-4-azido-5-fluoro-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-ol.
| Compound Name | (2R,3S,4R,5S,6S)-4-azido-5-fluoro-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 54019185 |
| Molecular Formula | C13H16FN3O4 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (2R,3S,4R,5S,6S)-4-azido-5-fluoro-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-ol |
| SMILES | [N-]=[N+]=N[C@@H]1[C@H](O)[C@@H](CO)O[C@H](OCc2ccccc2)[C@H]1F |
| InChI | InChI=1S/C13H16FN3O4/c14-10-11(16-17-15)12(19)9(6-18)21-13(10)20-7-8-4-2-1-3-5-8/h1-5,9-13,18-19H,6-7H2/t9-,10+,11+,12-,13+/m1/s1 |
| InChIKey | KXSVZMAXTFDVRZ-SJHCENCUSA-N |
| XLogP | 1.30 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|