C25H30O3S — CID 54032844
3-[(2,5-dimethylphenyl)methylsulfanyl]-6-(3-methylbutyl)-6-phenyloxane-2,4-dione (PubChem CID 54032844) has the molecular formula C25H30O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)methylsulfanyl]-6-(3-methylbutyl)-6-phenyloxane-2,4-dione.
| Compound Name | 3-[(2,5-dimethylphenyl)methylsulfanyl]-6-(3-methylbutyl)-6-phenyloxane-2,4-dione |
|---|---|
| PubChem CID | 54032844 |
| Molecular Formula | C25H30O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)methylsulfanyl]-6-(3-methylbutyl)-6-phenyloxane-2,4-dione |
| SMILES | Cc1ccc(C)c(CSC2C(=O)CC(CCC(C)C)(c3ccccc3)OC2=O)c1 |
| InChI | InChI=1S/C25H30O3S/c1-17(2)12-13-25(21-8-6-5-7-9-21)15-22(26)23(24(27)28-25)29-16-20-14-18(3)10-11-19(20)4/h5-11,14,17,23H,12-13,15-16H2,1-4H3 |
| InChIKey | LGVILTVQZRREIJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|