2,2-bis(hydroxymethyl)hexyl hydrogen carbonate

C9H18O5 — CID 54042494

IUPAC2,2-bis(hydroxymethyl)hexyl hydrogen carbonate
SMILESCCCCC(CO)(CO)COC(=O)O
InChIInChI=1S/C9H18O5/c1-2-3-4-9(5-10,6-11)7-14-8(12)13/h10-11H,2-7H2,1H3,(H,12,13)
InChIKeyLNIBRWDKBGGMFH-UHFFFAOYSA-N
MW206.24 g/mol
LogP0.84
Rot. Bonds7

About 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate

2,2-bis(hydroxymethyl)hexyl hydrogen carbonate (PubChem CID 54042494) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate.

Molecular Properties

Compound Name2,2-bis(hydroxymethyl)hexyl hydrogen carbonate
PubChem CID54042494
Molecular FormulaC9H18O5
Molecular Weight206.24 g/mol
Exact Mass206.12
IUPAC Name2,2-bis(hydroxymethyl)hexyl hydrogen carbonate
SMILESCCCCC(CO)(CO)COC(=O)O
InChIInChI=1S/C9H18O5/c1-2-3-4-9(5-10,6-11)7-14-8(12)13/h10-11H,2-7H2,1H3,(H,12,13)
InChIKeyLNIBRWDKBGGMFH-UHFFFAOYSA-N
XLogP0.84
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.24
LogP ≤ 50.84
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate?
The IUPAC name of 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate (CID 54042494) is 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate.
What is the SMILES notation for 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate?
The canonical SMILES for 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate is CCCCC(CO)(CO)COC(=O)O.
What is the InChIKey of 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate?
The InChIKey is LNIBRWDKBGGMFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O5/c1-2-3-4-9(5-10,6-11)7-14-8(12)13/h10-11H,2-7H2,1H3,(H,12,13).
What are the key properties of 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate?
2,2-bis(hydroxymethyl)hexyl hydrogen carbonate has a molecular weight of 206.24 g/mol, XLogP of 0.84, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(hydroxymethyl)hexyl hydrogen carbonate is sourced from PubChem (CID 54042494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).