C23H27N3O2 — CID 54044853
2-(4-cyanoanilino)-2-[3-(cyclopentylamino)-5-methylphenyl]butanoic acid (PubChem CID 54044853) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[3-(cyclopentylamino)-5-methylphenyl]butanoic acid.
| Compound Name | 2-(4-cyanoanilino)-2-[3-(cyclopentylamino)-5-methylphenyl]butanoic acid |
|---|---|
| PubChem CID | 54044853 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[3-(cyclopentylamino)-5-methylphenyl]butanoic acid |
| SMILES | CCC(Nc1ccc(C#N)cc1)(C(=O)O)c1cc(C)cc(NC2CCCC2)c1 |
| InChI | InChI=1S/C23H27N3O2/c1-3-23(22(27)28,26-20-10-8-17(15-24)9-11-20)18-12-16(2)13-21(14-18)25-19-6-4-5-7-19/h8-14,19,25-26H,3-7H2,1-2H3,(H,27,28) |
| InChIKey | LOVNVOMOUXINJM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |