C22H22N4O3 — CID 54185838
2-(4-cyanoanilino)-2-[3-ethoxy-5-(1H-imidazol-2-yl)phenyl]butanoic acid (PubChem CID 54185838) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[3-ethoxy-5-(1H-imidazol-2-yl)phenyl]butanoic acid.
| Compound Name | 2-(4-cyanoanilino)-2-[3-ethoxy-5-(1H-imidazol-2-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 54185838 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[3-ethoxy-5-(1H-imidazol-2-yl)phenyl]butanoic acid |
| SMILES | CCOc1cc(-c2ncc[nH]2)cc(C(CC)(Nc2ccc(C#N)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C22H22N4O3/c1-3-22(21(27)28,26-18-7-5-15(14-23)6-8-18)17-11-16(20-24-9-10-25-20)12-19(13-17)29-4-2/h5-13,26H,3-4H2,1-2H3,(H,24,25)(H,27,28) |
| InChIKey | PFAURAQLPCXVPV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |