C22H24N2O5S — CID 54364332
2-(4-cyanoanilino)-2-[4-(2-ethoxy-2-oxoethoxy)-3-methylsulfanylphenyl]butanoic acid (PubChem CID 54364332) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[4-(2-ethoxy-2-oxoethoxy)-3-methylsulfanylphenyl]butanoic acid.
| Compound Name | 2-(4-cyanoanilino)-2-[4-(2-ethoxy-2-oxoethoxy)-3-methylsulfanylphenyl]butanoic acid |
|---|---|
| PubChem CID | 54364332 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[4-(2-ethoxy-2-oxoethoxy)-3-methylsulfanylphenyl]butanoic acid |
| SMILES | CCOC(=O)COc1ccc(C(CC)(Nc2ccc(C#N)cc2)C(=O)O)cc1SC |
| InChI | InChI=1S/C22H24N2O5S/c1-4-22(21(26)27,24-17-9-6-15(13-23)7-10-17)16-8-11-18(19(12-16)30-3)29-14-20(25)28-5-2/h6-12,24H,4-5,14H2,1-3H3,(H,26,27) |
| InChIKey | UOSISOJZVHUIQL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |