C28H37N3O8 — CID 54355525
2-[5-ethoxy-2-(2-ethoxy-2-oxoethoxy)phenyl]-2-[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]anilino]butanoic acid (PubChem CID 54355525) has the molecular formula C28H37N3O8 and a molecular weight of 543.62 g/mol. Its IUPAC name is 2-[5-ethoxy-2-(2-ethoxy-2-oxoethoxy)phenyl]-2-[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]anilino]butanoic acid.
| Compound Name | 2-[5-ethoxy-2-(2-ethoxy-2-oxoethoxy)phenyl]-2-[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]anilino]butanoic acid |
|---|---|
| PubChem CID | 54355525 |
| Molecular Formula | C28H37N3O8 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 2-[5-ethoxy-2-(2-ethoxy-2-oxoethoxy)phenyl]-2-[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]anilino]butanoic acid |
| SMILES | CCOC(=O)COc1ccc(OCC)cc1C(CC)(Nc1ccc(C=NNC(=O)OC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C28H37N3O8/c1-7-28(25(33)34,22-16-21(36-8-2)14-15-23(22)38-18-24(32)37-9-3)30-20-12-10-19(11-13-20)17-29-31-26(35)39-27(4,5)6/h10-17,30H,7-9,18H2,1-6H3,(H,31,35)(H,33,34) |
| InChIKey | UIVOHZSOQJRDIO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|